C31H42Cl2N4O3 — CID 130218688
7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-N-(2,4-dimethylpentan-2-yl)-2-oxo-3,4-dihydroquinoline-1-carboxamide (PubChem CID 130218688) has the molecular formula C31H42Cl2N4O3 and a molecular weight of 589.61 g/mol. Its IUPAC name is 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-N-(2,4-dimethylpentan-2-yl)-2-oxo-3,4-dihydroquinoline-1-carboxamide.
| Compound Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-N-(2,4-dimethylpentan-2-yl)-2-oxo-3,4-dihydroquinoline-1-carboxamide |
|---|---|
| PubChem CID | 130218688 |
| Molecular Formula | C31H42Cl2N4O3 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-N-(2,4-dimethylpentan-2-yl)-2-oxo-3,4-dihydroquinoline-1-carboxamide |
| SMILES | CC(C)CC(C)(C)NC(=O)N1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C31H42Cl2N4O3/c1-22(2)21-31(3,4)34-30(39)37-27-20-24(12-10-23(27)11-13-28(37)38)40-19-6-5-14-35-15-17-36(18-16-35)26-9-7-8-25(32)29(26)33/h7-10,12,20,22H,5-6,11,13-19,21H2,1-4H3,(H,34,39) |
| InChIKey | ZIWPHNCJDBGNGA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|