C31H34Cl2N4O3 — CID 56596955
N-benzyl-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinoline-1-carboxamide (PubChem CID 56596955) has the molecular formula C31H34Cl2N4O3 and a molecular weight of 581.54 g/mol. Its IUPAC name is N-benzyl-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinoline-1-carboxamide.
| Compound Name | N-benzyl-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinoline-1-carboxamide |
|---|---|
| PubChem CID | 56596955 |
| Molecular Formula | C31H34Cl2N4O3 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | N-benzyl-7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinoline-1-carboxamide |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C31H34Cl2N4O3/c32-26-9-6-10-27(30(26)33)36-18-16-35(17-19-36)15-4-5-20-40-25-13-11-24-12-14-29(38)37(28(24)21-25)31(39)34-22-23-7-2-1-3-8-23/h1-3,6-11,13,21H,4-5,12,14-20,22H2,(H,34,39) |
| InChIKey | CFDJAKYNEQYXMN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|