C26H31Cl2N3O5S — CID 167181397
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl methoxysulfanylformate (PubChem CID 167181397) has the molecular formula C26H31Cl2N3O5S and a molecular weight of 568.52 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl methoxysulfanylformate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl methoxysulfanylformate |
|---|---|
| PubChem CID | 167181397 |
| Molecular Formula | C26H31Cl2N3O5S |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl methoxysulfanylformate |
| SMILES | COSC(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C26H31Cl2N3O5S/c1-34-37-26(33)36-18-31-23-17-20(9-7-19(23)8-10-24(31)32)35-16-3-2-11-29-12-14-30(15-13-29)22-6-4-5-21(27)25(22)28/h4-7,9,17H,2-3,8,10-16,18H2,1H3 |
| InChIKey | SCNQNLADKGOCGT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|