C35H49Cl2N3O5 — CID 130432224
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 3,5-dimethyloctyl carbonate (PubChem CID 130432224) has the molecular formula C35H49Cl2N3O5 and a molecular weight of 662.70 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 3,5-dimethyloctyl carbonate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 3,5-dimethyloctyl carbonate |
|---|---|
| PubChem CID | 130432224 |
| Molecular Formula | C35H49Cl2N3O5 |
| Molecular Weight | 662.70 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 3,5-dimethyloctyl carbonate |
| SMILES | CCCC(C)CC(C)CCOC(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C35H49Cl2N3O5/c1-4-8-26(2)23-27(3)15-22-44-35(42)45-25-40-32-24-29(13-11-28(32)12-14-33(40)41)43-21-6-5-16-38-17-19-39(20-18-38)31-10-7-9-30(36)34(31)37/h7,9-11,13,24,26-27H,4-6,8,12,14-23,25H2,1-3H3 |
| InChIKey | HYXSEPUSTPZOPS-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.70 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|