C30H40Cl2N4O4 — CID 58096717
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-amino-4-methylpentanoate (PubChem CID 58096717) has the molecular formula C30H40Cl2N4O4 and a molecular weight of 591.58 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-amino-4-methylpentanoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 58096717 |
| Molecular Formula | C30H40Cl2N4O4 |
| Molecular Weight | 591.58 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-amino-4-methylpentanoate |
| SMILES | CC(C)CC(N)C(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C30H40Cl2N4O4/c1-21(2)18-25(33)30(38)40-20-36-27-19-23(10-8-22(27)9-11-28(36)37)39-17-4-3-12-34-13-15-35(16-14-34)26-7-5-6-24(31)29(26)32/h5-8,10,19,21,25H,3-4,9,11-18,20,33H2,1-2H3 |
| InChIKey | KOYUISYFZRETPF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|