C27H35ClN4O4 — CID 155107760
[7-[4-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl N-methylcarbamate (PubChem CID 155107760) has the molecular formula C27H35ClN4O4 and a molecular weight of 515.05 g/mol. Its IUPAC name is [7-[4-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl N-methylcarbamate.
| Compound Name | [7-[4-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 155107760 |
| Molecular Formula | C27H35ClN4O4 |
| Molecular Weight | 515.05 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | [7-[4-[4-(2-chloro-3-methylphenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(C)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C27H35ClN4O4/c1-20-6-5-7-23(26(20)28)31-15-13-30(14-16-31)12-3-4-17-35-22-10-8-21-9-11-25(33)32(24(21)18-22)19-36-27(34)29-2/h5-8,10,18H,3-4,9,11-17,19H2,1-2H3,(H,29,34) |
| InChIKey | QFDPFCBPKRUYHC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|