C27H31Cl2N3O6 — CID 56597051
acetyloxymethyl 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinoline-1-carboxylate (PubChem CID 56597051) has the molecular formula C27H31Cl2N3O6 and a molecular weight of 564.47 g/mol. Its IUPAC name is acetyloxymethyl 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinoline-1-carboxylate.
| Compound Name | acetyloxymethyl 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 56597051 |
| Molecular Formula | C27H31Cl2N3O6 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | acetyloxymethyl 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinoline-1-carboxylate |
| SMILES | CC(=O)OCOC(=O)N1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C27H31Cl2N3O6/c1-19(33)37-18-38-27(35)32-24-17-21(9-7-20(24)8-10-25(32)34)36-16-3-2-11-30-12-14-31(15-13-30)23-6-4-5-22(28)26(23)29/h4-7,9,17H,2-3,8,10-16,18H2,1H3 |
| InChIKey | AELHAPFJWYCLKT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|