C27H34Cl2N4O4 — CID 58096612
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-aminopropanoate (PubChem CID 58096612) has the molecular formula C27H34Cl2N4O4 and a molecular weight of 549.50 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-aminopropanoate.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-aminopropanoate |
|---|---|
| PubChem CID | 58096612 |
| Molecular Formula | C27H34Cl2N4O4 |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-aminopropanoate |
| SMILES | CC(N)C(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc21 |
| InChI | InChI=1S/C27H34Cl2N4O4/c1-19(30)27(35)37-18-33-24-17-21(9-7-20(24)8-10-25(33)34)36-16-3-2-11-31-12-14-32(15-13-31)23-6-4-5-22(28)26(23)29/h4-7,9,17,19H,2-3,8,10-16,18,30H2,1H3 |
| InChIKey | AXLLSFNNYSZBNO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|