C38H53N3O4S — CID 89435180
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-pentylheptanoate (PubChem CID 89435180) has the molecular formula C38H53N3O4S and a molecular weight of 647.93 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-pentylheptanoate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-pentylheptanoate |
|---|---|
| PubChem CID | 89435180 |
| Molecular Formula | C38H53N3O4S |
| Molecular Weight | 647.93 g/mol |
| Exact Mass | 647.38 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl 2-pentylheptanoate |
| SMILES | CCCCCC(CCCCC)C(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C38H53N3O4S/c1-3-5-7-12-31(13-8-6-4-2)38(43)45-29-41-35-28-32(18-16-30(35)17-19-37(41)42)44-26-10-9-21-39-22-24-40(25-23-39)34-14-11-15-36-33(34)20-27-46-36/h11,14-16,18,20,27-28,31H,3-10,12-13,17,19,21-26,29H2,1-2H3 |
| InChIKey | WQZAAOYXZXSBIU-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.93 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|