C39H56N4O4S — CID 89435395
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-2-oxo-3H-quinolin-1-yl]methyl N-decylcarbamate (PubChem CID 89435395) has the molecular formula C39H56N4O4S and a molecular weight of 676.97 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-2-oxo-3H-quinolin-1-yl]methyl N-decylcarbamate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-2-oxo-3H-quinolin-1-yl]methyl N-decylcarbamate |
|---|---|
| PubChem CID | 89435395 |
| Molecular Formula | C39H56N4O4S |
| Molecular Weight | 676.97 g/mol |
| Exact Mass | 676.40 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-2-oxo-3H-quinolin-1-yl]methyl N-decylcarbamate |
| SMILES | CCCCCCCCCCNC(=O)OCN1C(=O)CC(C)(C)c2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C39H56N4O4S/c1-4-5-6-7-8-9-10-11-20-40-38(45)47-30-43-35-28-31(17-18-33(35)39(2,3)29-37(43)44)46-26-13-12-21-41-22-24-42(25-23-41)34-15-14-16-36-32(34)19-27-48-36/h14-19,27-28H,4-13,20-26,29-30H2,1-3H3,(H,40,45) |
| InChIKey | IROUPPHRLHSZMR-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.97 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|