C33H41N3O4S — CID 89435629
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl heptanoate (PubChem CID 89435629) has the molecular formula C33H41N3O4S and a molecular weight of 575.78 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl heptanoate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl heptanoate |
|---|---|
| PubChem CID | 89435629 |
| Molecular Formula | C33H41N3O4S |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl heptanoate |
| SMILES | CCCCCCC(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C33H41N3O4S/c1-2-3-4-5-11-33(38)40-25-36-30-24-27(14-12-26(30)13-15-32(36)37)39-22-7-6-17-34-18-20-35(21-19-34)29-9-8-10-31-28(29)16-23-41-31/h8-10,12-16,23-24H,2-7,11,17-22,25H2,1H3 |
| InChIKey | LOROWDMTWYZZFT-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|