C31H36ClN3O5S — CID 144550110
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 4-chlorobutyl carbonate (PubChem CID 144550110) has the molecular formula C31H36ClN3O5S and a molecular weight of 598.16 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 4-chlorobutyl carbonate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 4-chlorobutyl carbonate |
|---|---|
| PubChem CID | 144550110 |
| Molecular Formula | C31H36ClN3O5S |
| Molecular Weight | 598.16 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 4-chlorobutyl carbonate |
| SMILES | O=C(OCCCCCl)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C31H36ClN3O5S/c32-13-1-3-20-39-31(37)40-23-35-28-22-25(10-8-24(28)9-11-30(35)36)38-19-4-2-14-33-15-17-34(18-16-33)27-6-5-7-29-26(27)12-21-41-29/h5-12,21-22H,1-4,13-20,23H2 |
| InChIKey | WCAFOOBLIFDRMZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.16 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|