C31H38N4O4S — CID 123254582
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 4-(methylamino)butanoate (PubChem CID 123254582) has the molecular formula C31H38N4O4S and a molecular weight of 562.74 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 4-(methylamino)butanoate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 4-(methylamino)butanoate |
|---|---|
| PubChem CID | 123254582 |
| Molecular Formula | C31H38N4O4S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 4-(methylamino)butanoate |
| SMILES | CNCCCC(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C31H38N4O4S/c1-32-14-5-8-31(37)39-23-35-28-22-25(11-9-24(28)10-12-30(35)36)38-20-3-2-15-33-16-18-34(19-17-33)27-6-4-7-29-26(27)13-21-40-29/h4,6-7,9-13,21-22,32H,2-3,5,8,14-20,23H2,1H3 |
| InChIKey | DMGNOEPUMVKSCK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|