C38H51N3O4S — CID 89435242
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 2,2-dimethyldecanoate (PubChem CID 89435242) has the molecular formula C38H51N3O4S and a molecular weight of 645.91 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 2,2-dimethyldecanoate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 2,2-dimethyldecanoate |
|---|---|
| PubChem CID | 89435242 |
| Molecular Formula | C38H51N3O4S |
| Molecular Weight | 645.91 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 2,2-dimethyldecanoate |
| SMILES | CCCCCCCCC(C)(C)C(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C38H51N3O4S/c1-4-5-6-7-8-9-20-38(2,3)37(43)45-29-41-34-28-31(17-15-30(34)16-18-36(41)42)44-26-11-10-21-39-22-24-40(25-23-39)33-13-12-14-35-32(33)19-27-46-35/h12-19,27-28H,4-11,20-26,29H2,1-3H3 |
| InChIKey | GNQRAJBMSJVBNG-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.91 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|