C35H38N4O4S — CID 71295565
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl N-benzyl-N-methylcarbamate (PubChem CID 71295565) has the molecular formula C35H38N4O4S and a molecular weight of 610.78 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl N-benzyl-N-methylcarbamate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl N-benzyl-N-methylcarbamate |
|---|---|
| PubChem CID | 71295565 |
| Molecular Formula | C35H38N4O4S |
| Molecular Weight | 610.78 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl N-benzyl-N-methylcarbamate |
| SMILES | CN(Cc1ccccc1)C(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C35H38N4O4S/c1-36(25-27-8-3-2-4-9-27)35(41)43-26-39-32-24-29(14-12-28(32)13-15-34(39)40)42-22-6-5-17-37-18-20-38(21-19-37)31-10-7-11-33-30(31)16-23-44-33/h2-4,7-16,23-24H,5-6,17-22,25-26H2,1H3 |
| InChIKey | DRKUCMLFXWNWHW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 67.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.78 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|