C51H67N3O4S — CID 123301959
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl pentacosa-7,10,13,16,19-pentaenoate (PubChem CID 123301959) has the molecular formula C51H67N3O4S and a molecular weight of 818.18 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl pentacosa-7,10,13,16,19-pentaenoate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl pentacosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 123301959 |
| Molecular Formula | C51H67N3O4S |
| Molecular Weight | 818.18 g/mol |
| Exact Mass | 817.49 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl pentacosa-7,10,13,16,19-pentaenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C51H67N3O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-29-51(56)58-43-54-48-42-45(32-30-44(48)31-33-50(54)55)57-40-25-24-35-52-36-38-53(39-37-52)47-27-26-28-49-46(47)34-41-59-49/h6-7,9-10,12-13,15-16,18-19,26-28,30-34,41-42H,2-5,8,11,14,17,20-25,29,35-40,43H2,1H3 |
| InChIKey | GZBXCIQFAUHYNM-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.18 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|