C43H55N3O3S — CID 89435431
7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]quinolin-2-one (PubChem CID 89435431) has the molecular formula C43H55N3O3S and a molecular weight of 694.00 g/mol. Its IUPAC name is 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]quinolin-2-one.
| Compound Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]quinolin-2-one |
|---|---|
| PubChem CID | 89435431 |
| Molecular Formula | C43H55N3O3S |
| Molecular Weight | 694.00 g/mol |
| Exact Mass | 693.40 |
| IUPAC Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]quinolin-2-one |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)n1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C43H55N3O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-42(47)46-40-35-37(25-23-36(40)24-26-43(46)48)49-33-18-17-28-44-29-31-45(32-30-44)39-20-19-21-41-38(39)27-34-50-41/h3-4,6-7,9-10,19-21,23-27,34-35H,2,5,8,11-18,22,28-33H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | XHTRPTBFOKRSHP-PDBXOOCHSA-N |
| XLogP | 10.43 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.00 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|