C33H41N5O4S — CID 89435460
2-amino-N-[2-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-2-oxoethyl]-4-methylpentanamide (PubChem CID 89435460) has the molecular formula C33H41N5O4S and a molecular weight of 603.79 g/mol. Its IUPAC name is 2-amino-N-[2-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-2-oxoethyl]-4-methylpentanamide.
| Compound Name | 2-amino-N-[2-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-2-oxoethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 89435460 |
| Molecular Formula | C33H41N5O4S |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | 2-amino-N-[2-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]-2-oxoethyl]-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)NCC(=O)n1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C33H41N5O4S/c1-23(2)20-27(34)33(41)35-22-32(40)38-29-21-25(10-8-24(29)9-11-31(38)39)42-18-4-3-13-36-14-16-37(17-15-36)28-6-5-7-30-26(28)12-19-43-30/h5-12,19,21,23,27H,3-4,13-18,20,22,34H2,1-2H3,(H,35,41) |
| InChIKey | FFAVTRBNFRGLRV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|