C32H33N3O5S2 — CID 87190867
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl] 4-methylbenzenesulfonate (PubChem CID 87190867) has the molecular formula C32H33N3O5S2 and a molecular weight of 603.77 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87190867 |
| Molecular Formula | C32H33N3O5S2 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)On2c(=O)ccc3ccc(OCCCCN4CCN(c5cccc6sccc56)CC4)cc32)cc1 |
| InChI | InChI=1S/C32H33N3O5S2/c1-24-7-12-27(13-8-24)42(37,38)40-35-30-23-26(11-9-25(30)10-14-32(35)36)39-21-3-2-16-33-17-19-34(20-18-33)29-5-4-6-31-28(29)15-22-41-31/h4-15,22-23H,2-3,16-21H2,1H3 |
| InChIKey | YZKOSBHWLQSRJD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|