C30H36N4O4S — CID 89435467
1-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]ethyl N,N-dimethylcarbamate (PubChem CID 89435467) has the molecular formula C30H36N4O4S and a molecular weight of 548.71 g/mol. Its IUPAC name is 1-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]ethyl N,N-dimethylcarbamate.
| Compound Name | 1-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]ethyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 89435467 |
| Molecular Formula | C30H36N4O4S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 1-[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]ethyl N,N-dimethylcarbamate |
| SMILES | CC(OC(=O)N(C)C)n1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C30H36N4O4S/c1-22(38-30(36)31(2)3)34-27-21-24(11-9-23(27)10-12-29(34)35)37-19-5-4-14-32-15-17-33(18-16-32)26-7-6-8-28-25(26)13-20-39-28/h6-13,20-22H,4-5,14-19H2,1-3H3 |
| InChIKey | FUVQQVAXPAMSNM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|