C26H28CaN3O6PS — CID 140666088
calcium [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl phosphate (PubChem CID 140666088) has the molecular formula C26H28CaN3O6PS and a molecular weight of 581.64 g/mol. Its IUPAC name is calcium [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl phosphate.
| Compound Name | calcium [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 140666088 |
| Molecular Formula | C26H28CaN3O6PS |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | calcium [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl phosphate |
| SMILES | O=c1ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc2n1COP(=O)([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C26H30N3O6PS.Ca/c30-26-9-7-20-6-8-21(18-24(20)29(26)19-35-36(31,32)33)34-16-2-1-11-27-12-14-28(15-13-27)23-4-3-5-25-22(23)10-17-37-25;/h3-10,17-18H,1-2,11-16,19H2,(H2,31,32,33);/q;+2/p-2 |
| InChIKey | YMCDJBFVYOPPFF-UHFFFAOYSA-L |
| XLogP | 2.62 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|