C32H38N4O6S — CID 89435321
methyl 4-[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methoxycarbonylamino]butanoate (PubChem CID 89435321) has the molecular formula C32H38N4O6S and a molecular weight of 606.75 g/mol. Its IUPAC name is methyl 4-[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methoxycarbonylamino]butanoate.
| Compound Name | methyl 4-[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 89435321 |
| Molecular Formula | C32H38N4O6S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | methyl 4-[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methoxycarbonylamino]butanoate |
| SMILES | COC(=O)CCCNC(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C32H38N4O6S/c1-40-31(38)8-5-14-33-32(39)42-23-36-28-22-25(11-9-24(28)10-12-30(36)37)41-20-3-2-15-34-16-18-35(19-17-34)27-6-4-7-29-26(27)13-21-43-29/h4,6-7,9-13,21-22H,2-3,5,8,14-20,23H2,1H3,(H,33,39) |
| InChIKey | QZUGDWVOVZIERK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|