C44H57N3O4S — CID 89435224
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 89435224) has the molecular formula C44H57N3O4S and a molecular weight of 724.02 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 89435224 |
| Molecular Formula | C44H57N3O4S |
| Molecular Weight | 724.02 g/mol |
| Exact Mass | 723.41 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCn1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C44H57N3O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-44(49)51-36-47-41-35-38(25-23-37(41)24-26-43(47)48)50-33-18-17-28-45-29-31-46(32-30-45)40-20-19-21-42-39(40)27-34-52-42/h3-4,6-7,9-10,19-21,23-27,34-35H,2,5,8,11-18,22,28-33,36H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | IHFAXEZJJQMODA-PDBXOOCHSA-N |
| XLogP | 10.29 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.02 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|