C32H37N5O4S — CID 89435583
1-[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-one (PubChem CID 89435583) has the molecular formula C32H37N5O4S and a molecular weight of 587.75 g/mol. Its IUPAC name is 1-[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-one.
| Compound Name | 1-[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-one |
|---|---|
| PubChem CID | 89435583 |
| Molecular Formula | C32H37N5O4S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | 1-[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]-7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]quinolin-2-one |
| SMILES | NCC(=O)N1CCCC1C(=O)n1c(=O)ccc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C32H37N5O4S/c33-22-31(39)36-14-4-6-27(36)32(40)37-28-21-24(10-8-23(28)9-11-30(37)38)41-19-2-1-13-34-15-17-35(18-16-34)26-5-3-7-29-25(26)12-20-42-29/h3,5,7-12,20-21,27H,1-2,4,6,13-19,22,33H2 |
| InChIKey | GFDNIHSKNSYLEA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|