C39H57N3O5S — CID 134395118
7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[[decoxy(hydroxy)methoxy]methyl]-4,4-dimethyl-3H-quinolin-2-one (PubChem CID 134395118) has the molecular formula C39H57N3O5S and a molecular weight of 679.97 g/mol. Its IUPAC name is 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[[decoxy(hydroxy)methoxy]methyl]-4,4-dimethyl-3H-quinolin-2-one.
| Compound Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[[decoxy(hydroxy)methoxy]methyl]-4,4-dimethyl-3H-quinolin-2-one |
|---|---|
| PubChem CID | 134395118 |
| Molecular Formula | C39H57N3O5S |
| Molecular Weight | 679.97 g/mol |
| Exact Mass | 679.40 |
| IUPAC Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[[decoxy(hydroxy)methoxy]methyl]-4,4-dimethyl-3H-quinolin-2-one |
| SMILES | CCCCCCCCCCOC(O)OCN1C(=O)CC(C)(C)c2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C39H57N3O5S/c1-4-5-6-7-8-9-10-12-26-46-38(44)47-30-42-35-28-31(17-18-33(35)39(2,3)29-37(42)43)45-25-13-11-20-40-21-23-41(24-22-40)34-15-14-16-36-32(34)19-27-48-36/h14-19,27-28,38,44H,4-13,20-26,29-30H2,1-3H3 |
| InChIKey | ZZXYCOVJLMFFCL-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.97 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|