C34H45N3O4S — CID 89435376
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-2-oxo-3H-quinolin-1-yl]methyl 2-methylpentanoate (PubChem CID 89435376) has the molecular formula C34H45N3O4S and a molecular weight of 591.82 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-2-oxo-3H-quinolin-1-yl]methyl 2-methylpentanoate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-2-oxo-3H-quinolin-1-yl]methyl 2-methylpentanoate |
|---|---|
| PubChem CID | 89435376 |
| Molecular Formula | C34H45N3O4S |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-2-oxo-3H-quinolin-1-yl]methyl 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OCN1C(=O)CC(C)(C)c2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C34H45N3O4S/c1-5-9-25(2)33(39)41-24-37-30-22-26(12-13-28(30)34(3,4)23-32(37)38)40-20-7-6-15-35-16-18-36(19-17-35)29-10-8-11-31-27(29)14-21-42-31/h8,10-14,21-22,25H,5-7,9,15-20,23-24H2,1-4H3 |
| InChIKey | DOCBSUIMNAWKPA-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|