C62H76N6O8S2 — CID 154471910
bis[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl] 2,2,4,4-tetramethylhexanedioate (PubChem CID 154471910) has the molecular formula C62H76N6O8S2 and a molecular weight of 1097.46 g/mol. Its IUPAC name is bis[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl] 2,2,4,4-tetramethylhexanedioate.
| Compound Name | bis[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl] 2,2,4,4-tetramethylhexanedioate |
|---|---|
| PubChem CID | 154471910 |
| Molecular Formula | C62H76N6O8S2 |
| Molecular Weight | 1097.46 g/mol |
| Exact Mass | 1096.52 |
| IUPAC Name | bis[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methyl] 2,2,4,4-tetramethylhexanedioate |
| SMILES | CC(C)(CC(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21)CC(C)(C)C(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C62H76N6O8S2/c1-61(2,41-59(71)75-43-67-53-39-47(19-15-45(53)17-21-57(67)69)73-35-7-5-25-63-27-31-65(32-28-63)51-11-9-13-55-49(51)23-37-77-55)42-62(3,4)60(72)76-44-68-54-40-48(20-16-46(54)18-22-58(68)70)74-36-8-6-26-64-29-33-66(34-30-64)52-12-10-14-56-50(52)24-38-78-56/h9-16,19-20,23-24,37-40H,5-8,17-18,21-22,25-36,41-44H2,1-4H3 |
| InChIKey | NBFKKIWMHKKROB-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 124.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.46 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|