C31H37N3O6S — CID 151864058
5-[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methoxy]-5-oxopentanoic acid (PubChem CID 151864058) has the molecular formula C31H37N3O6S and a molecular weight of 579.72 g/mol. Its IUPAC name is 5-[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methoxy]-5-oxopentanoic acid.
| Compound Name | 5-[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 151864058 |
| Molecular Formula | C31H37N3O6S |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 5-[[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl]methoxy]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)OCN1C(=O)CCc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C31H37N3O6S/c35-29-12-10-23-9-11-24(21-27(23)34(29)22-40-31(38)8-4-7-30(36)37)39-19-2-1-14-32-15-17-33(18-16-32)26-5-3-6-28-25(26)13-20-41-28/h3,5-6,9,11,13,20-21H,1-2,4,7-8,10,12,14-19,22H2,(H,36,37) |
| InChIKey | SLHKOZUZSTVWEJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|