C25H30N3O6PS — CID 89435547
[7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] dihydrogen phosphate (PubChem CID 89435547) has the molecular formula C25H30N3O6PS and a molecular weight of 531.57 g/mol. Its IUPAC name is [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] dihydrogen phosphate.
| Compound Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 89435547 |
| Molecular Formula | C25H30N3O6PS |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | [7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] dihydrogen phosphate |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4cccc5sccc45)CC3)cc2N1OP(=O)(O)O |
| InChI | InChI=1S/C25H30N3O6PS/c29-25-9-7-19-6-8-20(18-23(19)28(25)34-35(30,31)32)33-16-2-1-11-26-12-14-27(15-13-26)22-4-3-5-24-21(22)10-17-36-24/h3-6,8,10,17-18H,1-2,7,9,11-16H2,(H2,30,31,32) |
| InChIKey | JUESIHUXIUZVRY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|