C23H26CaCl2N3O6P — CID 56597019
calcium [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] phosphate (PubChem CID 56597019) has the molecular formula C23H26CaCl2N3O6P and a molecular weight of 582.43 g/mol. Its IUPAC name is calcium [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] phosphate.
| Compound Name | calcium [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] phosphate |
|---|---|
| PubChem CID | 56597019 |
| Molecular Formula | C23H26CaCl2N3O6P |
| Molecular Weight | 582.43 g/mol |
| Exact Mass | 581.06 |
| IUPAC Name | calcium [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-oxo-3,4-dihydroquinolin-1-yl] phosphate |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1OP(=O)([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C23H28Cl2N3O6P.Ca/c24-19-4-3-5-20(23(19)25)27-13-11-26(12-14-27)10-1-2-15-33-18-8-6-17-7-9-22(29)28(21(17)16-18)34-35(30,31)32;/h3-6,8,16H,1-2,7,9-15H2,(H2,30,31,32);/q;+2/p-2 |
| InChIKey | XUFXHYFPHFAXFX-UHFFFAOYSA-L |
| XLogP | 2.63 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|