C30H36F3N3O3S — CID 89435428
7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-1-(2,2,2-trifluoroethoxymethyl)-3H-quinolin-2-one (PubChem CID 89435428) has the molecular formula C30H36F3N3O3S and a molecular weight of 575.70 g/mol. Its IUPAC name is 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-1-(2,2,2-trifluoroethoxymethyl)-3H-quinolin-2-one.
| Compound Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-1-(2,2,2-trifluoroethoxymethyl)-3H-quinolin-2-one |
|---|---|
| PubChem CID | 89435428 |
| Molecular Formula | C30H36F3N3O3S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-4,4-dimethyl-1-(2,2,2-trifluoroethoxymethyl)-3H-quinolin-2-one |
| SMILES | CC1(C)CC(=O)N(COCC(F)(F)F)c2cc(OCCCCN3CCN(c4cccc5sccc45)CC3)ccc21 |
| InChI | InChI=1S/C30H36F3N3O3S/c1-29(2)19-28(37)36(21-38-20-30(31,32)33)26-18-22(8-9-24(26)29)39-16-4-3-11-34-12-14-35(15-13-34)25-6-5-7-27-23(25)10-17-40-27/h5-10,17-18H,3-4,11-16,19-21H2,1-2H3 |
| InChIKey | NFKUQKASMUSSMV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|