C25H31Cl2N3O2 — CID 149358997
[7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-methylidene-3,4-dihydroquinolin-1-yl]methanol (PubChem CID 149358997) has the molecular formula C25H31Cl2N3O2 and a molecular weight of 476.45 g/mol. Its IUPAC name is [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-methylidene-3,4-dihydroquinolin-1-yl]methanol.
| Compound Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-methylidene-3,4-dihydroquinolin-1-yl]methanol |
|---|---|
| PubChem CID | 149358997 |
| Molecular Formula | C25H31Cl2N3O2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | [7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-2-methylidene-3,4-dihydroquinolin-1-yl]methanol |
| SMILES | C=C1CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1CO |
| InChI | InChI=1S/C25H31Cl2N3O2/c1-19-7-8-20-9-10-21(17-24(20)30(19)18-31)32-16-3-2-11-28-12-14-29(15-13-28)23-6-4-5-22(26)25(23)27/h4-6,9-10,17,31H,1-3,7-8,11-16,18H2 |
| InChIKey | YHNQBPXLPODSEP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|