C29H40ClN3O6 — CID 68977188
ethyl 4-[6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-3-oxo-1,4-benzoxazin-4-yl]butanoate;hydrochloride (PubChem CID 68977188) has the molecular formula C29H40ClN3O6 and a molecular weight of 562.11 g/mol. Its IUPAC name is ethyl 4-[6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-3-oxo-1,4-benzoxazin-4-yl]butanoate;hydrochloride.
| Compound Name | ethyl 4-[6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-3-oxo-1,4-benzoxazin-4-yl]butanoate;hydrochloride |
|---|---|
| PubChem CID | 68977188 |
| Molecular Formula | C29H40ClN3O6 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | ethyl 4-[6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-3-oxo-1,4-benzoxazin-4-yl]butanoate;hydrochloride |
| SMILES | CCOC(=O)CCCN1C(=O)COc2ccc(OCCCCN3CCN(c4ccccc4OC)CC3)cc21.Cl |
| InChI | InChI=1S/C29H39N3O6.ClH/c1-3-36-29(34)11-8-15-32-25-21-23(12-13-27(25)38-22-28(32)33)37-20-7-6-14-30-16-18-31(19-17-30)24-9-4-5-10-26(24)35-2;/h4-5,9-10,12-13,21H,3,6-8,11,14-20,22H2,1-2H3;1H |
| InChIKey | KDYYWXNYCMNBJZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|