C24H36N2O7 — CID 13302197
(E)-but-2-enedioic acid;ethyl 7-[4-(2-methoxyphenyl)piperazin-1-yl]heptanoate (PubChem CID 13302197) has the molecular formula C24H36N2O7 and a molecular weight of 464.56 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;ethyl 7-[4-(2-methoxyphenyl)piperazin-1-yl]heptanoate.
| Compound Name | (E)-but-2-enedioic acid;ethyl 7-[4-(2-methoxyphenyl)piperazin-1-yl]heptanoate |
|---|---|
| PubChem CID | 13302197 |
| Molecular Formula | C24H36N2O7 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (E)-but-2-enedioic acid;ethyl 7-[4-(2-methoxyphenyl)piperazin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1CCN(c2ccccc2OC)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H32N2O3.C4H4O4/c1-3-25-20(23)12-6-4-5-9-13-21-14-16-22(17-15-21)18-10-7-8-11-19(18)24-2;5-3(6)1-2-4(7)8/h7-8,10-11H,3-6,9,12-17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HCZZEIJLVGYBEP-WLHGVMLRSA-N |
| XLogP | 3.04 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|