C26H38ClN3O2 — CID 162674778
6-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(4-propan-2-ylphenyl)hexanamide;hydrochloride (PubChem CID 162674778) has the molecular formula C26H38ClN3O2 and a molecular weight of 460.06 g/mol. Its IUPAC name is 6-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(4-propan-2-ylphenyl)hexanamide;hydrochloride.
| Compound Name | 6-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(4-propan-2-ylphenyl)hexanamide;hydrochloride |
|---|---|
| PubChem CID | 162674778 |
| Molecular Formula | C26H38ClN3O2 |
| Molecular Weight | 460.06 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 6-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(4-propan-2-ylphenyl)hexanamide;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCCCC(=O)Nc2ccc(C(C)C)cc2)CC1.Cl |
| InChI | InChI=1S/C26H37N3O2.ClH/c1-21(2)22-12-14-23(15-13-22)27-26(30)11-5-4-8-16-28-17-19-29(20-18-28)24-9-6-7-10-25(24)31-3;/h6-7,9-10,12-15,21H,4-5,8,11,16-20H2,1-3H3,(H,27,30);1H |
| InChIKey | XVAGFQLCFQWGDL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.06 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|