C27H40ClN3O2 — CID 162673635
N-(4-butan-2-ylphenyl)-6-[4-(2-methoxyphenyl)piperazin-1-yl]hexanamide;hydrochloride (PubChem CID 162673635) has the molecular formula C27H40ClN3O2 and a molecular weight of 474.09 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-6-[4-(2-methoxyphenyl)piperazin-1-yl]hexanamide;hydrochloride.
| Compound Name | N-(4-butan-2-ylphenyl)-6-[4-(2-methoxyphenyl)piperazin-1-yl]hexanamide;hydrochloride |
|---|---|
| PubChem CID | 162673635 |
| Molecular Formula | C27H40ClN3O2 |
| Molecular Weight | 474.09 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-6-[4-(2-methoxyphenyl)piperazin-1-yl]hexanamide;hydrochloride |
| SMILES | CCC(C)c1ccc(NC(=O)CCCCCN2CCN(c3ccccc3OC)CC2)cc1.Cl |
| InChI | InChI=1S/C27H39N3O2.ClH/c1-4-22(2)23-13-15-24(16-14-23)28-27(31)12-6-5-9-17-29-18-20-30(21-19-29)25-10-7-8-11-26(25)32-3;/h7-8,10-11,13-16,22H,4-6,9,12,17-21H2,1-3H3,(H,28,31);1H |
| InChIKey | HDPUDIPOIFUECM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.09 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|