C20H22Cl3N3O2 — CID 142695553
3-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3,4,5-trichlorophenyl)propanamide (PubChem CID 142695553) has the molecular formula C20H22Cl3N3O2 and a molecular weight of 442.77 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3,4,5-trichlorophenyl)propanamide.
| Compound Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 142695553 |
| Molecular Formula | C20H22Cl3N3O2 |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(3,4,5-trichlorophenyl)propanamide |
| SMILES | COc1ccccc1N1CCN(CCC(=O)Nc2cc(Cl)c(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H22Cl3N3O2/c1-28-18-5-3-2-4-17(18)26-10-8-25(9-11-26)7-6-19(27)24-14-12-15(21)20(23)16(22)13-14/h2-5,12-13H,6-11H2,1H3,(H,24,27) |
| InChIKey | PMFRCARZDOLYNM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|