C20H22Cl3N3O — CID 25169359
4-(4-phenylpiperazin-1-yl)-N-(3,4,5-trichlorophenyl)butanamide (PubChem CID 25169359) has the molecular formula C20H22Cl3N3O and a molecular weight of 426.78 g/mol. Its IUPAC name is 4-(4-phenylpiperazin-1-yl)-N-(3,4,5-trichlorophenyl)butanamide.
| Compound Name | 4-(4-phenylpiperazin-1-yl)-N-(3,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 25169359 |
| Molecular Formula | C20H22Cl3N3O |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-(4-phenylpiperazin-1-yl)-N-(3,4,5-trichlorophenyl)butanamide |
| SMILES | O=C(CCCN1CCN(c2ccccc2)CC1)Nc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl3N3O/c21-17-13-15(14-18(22)20(17)23)24-19(27)7-4-8-25-9-11-26(12-10-25)16-5-2-1-3-6-16/h1-3,5-6,13-14H,4,7-12H2,(H,24,27) |
| InChIKey | AWAIIWFYQQLHOS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|