C17H24N2O5 — CID 67053278
4-[2-(4-ethoxy-4-oxobutoxy)phenyl]piperazine-1-carboxylic acid (PubChem CID 67053278) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[2-(4-ethoxy-4-oxobutoxy)phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-(4-ethoxy-4-oxobutoxy)phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67053278 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[2-(4-ethoxy-4-oxobutoxy)phenyl]piperazine-1-carboxylic acid |
| SMILES | CCOC(=O)CCCOc1ccccc1N1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C17H24N2O5/c1-2-23-16(20)8-5-13-24-15-7-4-3-6-14(15)18-9-11-19(12-10-18)17(21)22/h3-4,6-7H,2,5,8-13H2,1H3,(H,21,22) |
| InChIKey | LVJOOMDHMXNYGS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|