C32H39N3O6 — CID 139945105
ethyl 6-[2-[4-[6-(3,4-dimethoxyphenyl)pyridine-2-carbonyl]piperazin-1-yl]phenoxy]hexanoate (PubChem CID 139945105) has the molecular formula C32H39N3O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is ethyl 6-[2-[4-[6-(3,4-dimethoxyphenyl)pyridine-2-carbonyl]piperazin-1-yl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[2-[4-[6-(3,4-dimethoxyphenyl)pyridine-2-carbonyl]piperazin-1-yl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 139945105 |
| Molecular Formula | C32H39N3O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | ethyl 6-[2-[4-[6-(3,4-dimethoxyphenyl)pyridine-2-carbonyl]piperazin-1-yl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccccc1N1CCN(C(=O)c2cccc(-c3ccc(OC)c(OC)c3)n2)CC1 |
| InChI | InChI=1S/C32H39N3O6/c1-4-40-31(36)15-6-5-9-22-41-28-14-8-7-13-27(28)34-18-20-35(21-19-34)32(37)26-12-10-11-25(33-26)24-16-17-29(38-2)30(23-24)39-3/h7-8,10-14,16-17,23H,4-6,9,15,18-22H2,1-3H3 |
| InChIKey | OVQBLQKHJKOBFR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|