C29H34N2O3 — CID 130280545
[5-(4-butoxyphenyl)-2-methylphenyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 130280545) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is [5-(4-butoxyphenyl)-2-methylphenyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-butoxyphenyl)-2-methylphenyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 130280545 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | [5-(4-butoxyphenyl)-2-methylphenyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCCCOc1ccc(-c2ccc(C)c(C(=O)N3CCN(c4ccccc4OC)CC3)c2)cc1 |
| InChI | InChI=1S/C29H34N2O3/c1-4-5-20-34-25-14-12-23(13-15-25)24-11-10-22(2)26(21-24)29(32)31-18-16-30(17-19-31)27-8-6-7-9-28(27)33-3/h6-15,21H,4-5,16-20H2,1-3H3 |
| InChIKey | WBMPBZPOATUVAZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|