C28H33N3O3S — CID 146231513
[4-(2-methoxyphenyl)piperazin-1-yl]-[2-methyl-5-(4-propoxyanilino)sulfanylphenyl]methanone (PubChem CID 146231513) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is [4-(2-methoxyphenyl)piperazin-1-yl]-[2-methyl-5-(4-propoxyanilino)sulfanylphenyl]methanone.
| Compound Name | [4-(2-methoxyphenyl)piperazin-1-yl]-[2-methyl-5-(4-propoxyanilino)sulfanylphenyl]methanone |
|---|---|
| PubChem CID | 146231513 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [4-(2-methoxyphenyl)piperazin-1-yl]-[2-methyl-5-(4-propoxyanilino)sulfanylphenyl]methanone |
| SMILES | CCCOc1ccc(NSc2ccc(C)c(C(=O)N3CCN(c4ccccc4OC)CC3)c2)cc1 |
| InChI | InChI=1S/C28H33N3O3S/c1-4-19-34-23-12-10-22(11-13-23)29-35-24-14-9-21(2)25(20-24)28(32)31-17-15-30(16-18-31)26-7-5-6-8-27(26)33-3/h5-14,20,29H,4,15-19H2,1-3H3 |
| InChIKey | KEHGQNYCAHSEGI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|