C25H32Cl2N2O3 — CID 18848584
(3,5-dichloro-4-heptoxyphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 18848584) has the molecular formula C25H32Cl2N2O3 and a molecular weight of 479.45 g/mol. Its IUPAC name is (3,5-dichloro-4-heptoxyphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (3,5-dichloro-4-heptoxyphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 18848584 |
| Molecular Formula | C25H32Cl2N2O3 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (3,5-dichloro-4-heptoxyphenyl)-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)N2CCN(c3ccccc3OC)CC2)cc1Cl |
| InChI | InChI=1S/C25H32Cl2N2O3/c1-3-4-5-6-9-16-32-24-20(26)17-19(18-21(24)27)25(30)29-14-12-28(13-15-29)22-10-7-8-11-23(22)31-2/h7-8,10-11,17-18H,3-6,9,12-16H2,1-2H3 |
| InChIKey | REHFANYKLREKQR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|