C22H26ClFN2O5S — CID 4824145
(4-butoxy-3-chloro-5-methoxyphenyl)-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 4824145) has the molecular formula C22H26ClFN2O5S and a molecular weight of 484.98 g/mol. Its IUPAC name is (4-butoxy-3-chloro-5-methoxyphenyl)-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (4-butoxy-3-chloro-5-methoxyphenyl)-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4824145 |
| Molecular Formula | C22H26ClFN2O5S |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | (4-butoxy-3-chloro-5-methoxyphenyl)-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)cc1OC |
| InChI | InChI=1S/C22H26ClFN2O5S/c1-3-4-13-31-21-19(23)14-16(15-20(21)30-2)22(27)25-9-11-26(12-10-25)32(28,29)18-7-5-17(24)6-8-18/h5-8,14-15H,3-4,9-13H2,1-2H3 |
| InChIKey | OCRXHZQYMJNKKZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|