C24H25ClN2O5S — CID 26865865
(3-chloro-4-ethoxy-5-methoxyphenyl)-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 26865865) has the molecular formula C24H25ClN2O5S and a molecular weight of 488.99 g/mol. Its IUPAC name is (3-chloro-4-ethoxy-5-methoxyphenyl)-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (3-chloro-4-ethoxy-5-methoxyphenyl)-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 26865865 |
| Molecular Formula | C24H25ClN2O5S |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (3-chloro-4-ethoxy-5-methoxyphenyl)-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCOc1c(Cl)cc(C(=O)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)cc1OC |
| InChI | InChI=1S/C24H25ClN2O5S/c1-3-32-23-21(25)15-19(16-22(23)31-2)24(28)26-10-12-27(13-11-26)33(29,30)20-9-8-17-6-4-5-7-18(17)14-20/h4-9,14-16H,3,10-13H2,1-2H3 |
| InChIKey | VIDXTLHOZBZYKE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |