C18H30N4O2 — CID 119903300
4-amino-1-[4-[2-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butan-1-one (PubChem CID 119903300) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-amino-1-[4-[2-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-amino-1-[4-[2-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119903300 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 4-amino-1-[4-[2-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butan-1-one |
| SMILES | CN(C)CCOc1ccccc1N1CCN(C(=O)CCCN)CC1 |
| InChI | InChI=1S/C18H30N4O2/c1-20(2)14-15-24-17-7-4-3-6-16(17)21-10-12-22(13-11-21)18(23)8-5-9-19/h3-4,6-7H,5,8-15,19H2,1-2H3 |
| InChIKey | KTZSVAJEMJTRFN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |