C18H29N3O3 — CID 119994243
4-[4-[2-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butanoic acid (PubChem CID 119994243) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[4-[2-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butanoic acid.
| Compound Name | 4-[4-[2-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 119994243 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 4-[4-[2-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butanoic acid |
| SMILES | CN(C)CCOc1ccccc1N1CCN(CCCC(=O)O)CC1 |
| InChI | InChI=1S/C18H29N3O3/c1-19(2)14-15-24-17-7-4-3-6-16(17)21-12-10-20(11-13-21)9-5-8-18(22)23/h3-4,6-7H,5,8-15H2,1-2H3,(H,22,23) |
| InChIKey | RTVDZBLYWFKRIK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |