C29H38N4O5 — CID 13387770
ethyl 6-[3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2,4-dioxoquinazolin-1-yl]hexanoate (PubChem CID 13387770) has the molecular formula C29H38N4O5 and a molecular weight of 522.65 g/mol. Its IUPAC name is ethyl 6-[3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2,4-dioxoquinazolin-1-yl]hexanoate.
| Compound Name | ethyl 6-[3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2,4-dioxoquinazolin-1-yl]hexanoate |
|---|---|
| PubChem CID | 13387770 |
| Molecular Formula | C29H38N4O5 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | ethyl 6-[3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2,4-dioxoquinazolin-1-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCn1c(=O)n(CCN2CCN(c3ccccc3OC)CC2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C29H38N4O5/c1-3-38-27(34)15-5-4-10-16-32-24-12-7-6-11-23(24)28(35)33(29(32)36)22-19-30-17-20-31(21-18-30)25-13-8-9-14-26(25)37-2/h6-9,11-14H,3-5,10,15-22H2,1-2H3 |
| InChIKey | ZQGQWOXJFISLNX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|