C26H32N4O2 — CID 141242869
1-[5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethanone (PubChem CID 141242869) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-[5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethanone.
| Compound Name | 1-[5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethanone |
|---|---|
| PubChem CID | 141242869 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 1-[5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethanone |
| SMILES | COc1ccccc1N1CCN(CCn2c3c(c4ccccc42)CN(C(C)=O)CC3)CC1 |
| InChI | InChI=1S/C26H32N4O2/c1-20(31)29-12-11-24-22(19-29)21-7-3-4-8-23(21)30(24)18-15-27-13-16-28(17-14-27)25-9-5-6-10-26(25)32-2/h3-10H,11-19H2,1-2H3 |
| InChIKey | NPYWHRVNIHYXEI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|