C26H34N4O4 — CID 13387790
1-(5-hydroxypentyl)-3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]quinazoline-2,4-dione (PubChem CID 13387790) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-(5-hydroxypentyl)-3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]quinazoline-2,4-dione.
| Compound Name | 1-(5-hydroxypentyl)-3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 13387790 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 1-(5-hydroxypentyl)-3-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]quinazoline-2,4-dione |
| SMILES | COc1ccccc1N1CCN(CCn2c(=O)c3ccccc3n(CCCCCO)c2=O)CC1 |
| InChI | InChI=1S/C26H34N4O4/c1-34-24-12-6-5-11-23(24)28-17-14-27(15-18-28)16-19-30-25(32)21-9-3-4-10-22(21)29(26(30)33)13-7-2-8-20-31/h3-6,9-12,31H,2,7-8,13-20H2,1H3 |
| InChIKey | ZTUDBKOGHVEHPH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|